
CAS 1261924-37-1
:5-(3,4-Dimethoxyphenyl)-2-methoxy-3-pyridinecarboxylic acid
Description:
5-(3,4-Dimethoxyphenyl)-2-methoxy-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and multiple methoxy groups. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and biological activity. The pyridine ring is known for its aromatic stability and can participate in various chemical reactions, making this compound potentially useful in medicinal chemistry and drug development. Additionally, the specific arrangement of substituents on the aromatic rings can affect the compound's electronic properties, potentially leading to interesting pharmacological effects. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H15NO5
InChI:InChI=1S/C15H15NO5/c1-19-12-5-4-9(7-13(12)20-2)10-6-11(15(17)18)14(21-3)16-8-10/h4-8H,1-3H3,(H,17,18)
InChI key:InChIKey=JTIDMVKSSQVXAW-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C=2C=C(C(O)=O)C(OC)=NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(3,4-dimethoxyphenyl)-2-methoxy-
- 5-(3,4-Dimethoxyphenyl)-2-methoxy-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.