CymitQuimica logo

CAS 1261924-76-8

:

4′-Ethoxy-5-hydroxy-2′-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:
4′-Ethoxy-5-hydroxy-2′-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an ethoxy group (-OEt) and a hydroxy group (-OH) on the biphenyl framework, contributing to its solubility and reactivity. The presence of a carboxylic acid group (-COOH) indicates that it can participate in acid-base reactions and may act as a weak acid. The methyl group (-CH3) at the 2' position adds to the compound's steric properties and influences its overall polarity. This compound may exhibit biological activity due to its functional groups, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure and functional groups suggest potential applications in various chemical and pharmaceutical fields.
Formula:C16H16O4
InChI:InChI=1S/C16H16O4/c1-3-20-14-4-5-15(10(2)6-14)11-7-12(16(18)19)9-13(17)8-11/h4-9,17H,3H2,1-2H3,(H,18,19)
InChI key:InChIKey=WERSPISJNVSGIV-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(C(O)=O)=CC(O)=C2)C=CC(OCC)=C1
Synonyms:
  • 4′-Ethoxy-5-hydroxy-2′-methyl[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-ethoxy-5-hydroxy-2′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.