CymitQuimica logo

CAS 1261924-88-2

:

5-Hydroxy-2′,5′-dimethoxy[1,1′-biphenyl]-3-carbonitrile

Description:
5-Hydroxy-2′,5′-dimethoxy[1,1′-biphenyl]-3-carbonitrile, with the CAS number 1261924-88-2, is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features hydroxyl (-OH) and methoxy (-OCH3) functional groups, contributing to its potential solubility and reactivity. The presence of a cyano group (-C≡N) at the 3-position enhances its chemical properties, making it a candidate for various synthetic applications. The methoxy groups can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological systems. Additionally, the hydroxyl group may impart hydrogen-bonding capabilities, which can be significant in biological and chemical interactions. Overall, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and related fields. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C15H13NO3
InChI:InChI=1S/C15H13NO3/c1-18-13-3-4-15(19-2)14(8-13)11-5-10(9-16)6-12(17)7-11/h3-8,17H,1-2H3
InChI key:InChIKey=YENSSYWXNDMADL-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(OC)C=C1)C2=CC(C#N)=CC(O)=C2
Synonyms:
  • 5-Hydroxy-2′,5′-dimethoxy[1,1′-biphenyl]-3-carbonitrile
  • [1,1′-Biphenyl]-3-carbonitrile, 5-hydroxy-2′,5′-dimethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.