CymitQuimica logo

CAS 1261925-14-7

:

5-(4-Carboxy-3-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid

Description:
5-(4-Carboxy-3-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid, identified by its CAS number 1261925-14-7, is a chemical compound characterized by its complex molecular structure, which includes a pyridine ring and multiple functional groups. This compound features a carboxylic acid group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of a methoxy group enhances its solubility in organic solvents and may influence its biological activity. Additionally, the fluorine atom in the phenyl ring can affect the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. This compound may be of interest in pharmaceutical research due to its structural features, which could confer specific biological activities or therapeutic effects. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be studied for applications in medicinal chemistry or as a potential drug candidate.
Formula:C14H10FNO5
InChI:InChI=1S/C14H10FNO5/c1-21-12-10(14(19)20)4-8(6-16-12)7-2-3-9(13(17)18)11(15)5-7/h2-6H,1H3,(H,17,18)(H,19,20)
InChI key:InChIKey=SDXKUGSXCAQVJC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1OC)C2=CC(F)=C(C(O)=O)C=C2
Synonyms:
  • 5-(4-Carboxy-3-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(4-carboxy-3-fluorophenyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.