
CAS 1261925-17-0
:3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
Description:
3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3′ and 5′ positions of the biphenyl moiety contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The hydroxyl group (-OH) at the 3-position and the aldehyde group (-CHO) at the 4-position further influence its chemical behavior, making it a versatile compound for various applications in organic synthesis and medicinal chemistry. This compound may exhibit interesting biological activities due to its functional groups, which can participate in hydrogen bonding and other interactions. Additionally, the fluorine substituents can affect the compound's lipophilicity and metabolic stability. Overall, 3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is a valuable compound for research in fields such as pharmaceuticals and materials science.
Formula:C13H8F2O2
InChI:InChI=1S/C13H8F2O2/c14-11-3-10(4-12(15)6-11)8-1-2-9(7-16)13(17)5-8/h1-7,17H
InChI key:InChIKey=DHHZECULNAMTJA-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2=CC(O)=C(C=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxaldehyde, 3′,5′-difluoro-3-hydroxy-
- 3′,5′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.