
CAS 1261925-35-2
:4′-Chloro-3′-cyano-5-nitro[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Chloro-3′-cyano-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex biphenyl structure, which includes various functional groups that contribute to its chemical properties. The presence of a chloro group, a cyano group, and a nitro group on the biphenyl framework indicates that this compound may exhibit significant reactivity and potential for various chemical transformations. The carboxylic acid functional group suggests that it can participate in acid-base reactions and may serve as a precursor for further chemical synthesis. Additionally, the nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This compound may also exhibit specific solubility characteristics depending on the solvent used, and its structural features could lead to interesting biological or pharmacological activities. Overall, the unique combination of substituents makes this compound a subject of interest in both synthetic chemistry and potential applications in materials science or medicinal chemistry.
Formula:C14H7ClN2O4
InChI:InChI=1S/C14H7ClN2O4/c15-13-2-1-8(3-11(13)7-16)9-4-10(14(18)19)6-12(5-9)17(20)21/h1-6H,(H,18,19)
InChI key:InChIKey=RIEVUPKCGHUMRD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC(C#N)=C(Cl)C=C2
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 4′-chloro-3′-cyano-5-nitro-
- 4′-Chloro-3′-cyano-5-nitro[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.