
CAS 1261925-48-7
:5-Bromo-2′-(methylthio)[1,1′-biphenyl]-3-ol
Description:
5-Bromo-2′-(methylthio)[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 5-position and a methylthio group at the 2′-position contributes to its unique chemical properties. The hydroxyl group (-OH) at the 3-position enhances its polarity and solubility in polar solvents, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit biological activity due to the presence of the bromine and methylthio substituents, which can influence its interaction with biological targets. Additionally, its structural features suggest potential applications in materials science, pharmaceuticals, or as a reagent in organic synthesis. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential for its handling and use in research or industrial applications.
Formula:C13H11BrOS
InChI:InChI=1S/C13H11BrOS/c1-16-13-5-3-2-4-12(13)9-6-10(14)8-11(15)7-9/h2-8,15H,1H3
InChI key:InChIKey=MPNFMHFATIVCQU-UHFFFAOYSA-N
SMILES:S(C)C1=C(C2=CC(Br)=CC(O)=C2)C=CC=C1
Synonyms:- 5-Bromo-2′-(methylthio)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-bromo-2′-(methylthio)-
- 3-Bromo-5-[2-(methylsulfanyl)phenyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.