
CAS 1261925-75-0
:4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxaldehyde
Description:
4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its complex structure, which includes a biphenyl framework substituted with a fluorine atom, a trifluoromethyl group, a hydroxyl group, and an aldehyde functional group. The presence of the trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and interactions in biological systems. The hydroxyl group contributes to its polarity, making it more soluble in polar solvents. The aldehyde functional group is reactive, allowing for further chemical modifications. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Its specific applications and behavior in various chemical environments would depend on the context of its use, including potential roles in synthesis or as a pharmaceutical intermediate. As with many fluorinated compounds, it may also exhibit distinct environmental and toxicological profiles that warrant careful consideration in its handling and application.
Formula:C14H8F4O2
InChI:InChI=1S/C14H8F4O2/c15-12-4-3-8(5-11(12)14(16,17)18)9-1-2-10(7-19)13(20)6-9/h1-7,20H
InChI key:InChIKey=BDTRRCIKLLFVPW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1F)C2=CC(O)=C(C=O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxaldehyde, 4′-fluoro-3-hydroxy-3′-(trifluoromethyl)-
- 4′-Fluoro-3-hydroxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.