CymitQuimica logo

CAS 1261926-11-7

:

N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide

Description:
N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide is a chemical compound characterized by its unique structure, which includes a biphenyl moiety substituted with a bromine atom and a hydroxyl group, along with a methanesulfonamide functional group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the hydroxyl and sulfonamide groups. The presence of the bromine atom may impart additional reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such modifications can influence biological activity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a specific class of organic molecules with diverse applications in chemical research and development.
Formula:C13H12BrNO3S
InChI:InChI=1S/C13H12BrNO3S/c1-19(17,18)15-12-4-2-3-9(6-12)10-5-11(14)8-13(16)7-10/h2-8,15-16H,1H3
InChI key:InChIKey=SELBCCMELZAXPP-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=C(O)C1)C2=CC(NS(C)(=O)=O)=CC=C2
Synonyms:
  • N-(3′-Bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)methanesulfonamide
  • Methanesulfonamide, N-(3′-bromo-5′-hydroxy[1,1′-biphenyl]-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.