CAS 1261926-34-4
:2′-Fluoro-3-methoxy[1,1′-biphenyl]-4-ol
Description:
2′-Fluoro-3-methoxy[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 2' position and a methoxy group at the 3 position on one of the phenyl rings, along with a hydroxyl group at the 4 position, contributes to its unique chemical properties. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The fluoro substituent may influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the methoxy group can provide electron-donating effects, which may stabilize certain reactive intermediates. Overall, 2′-Fluoro-3-methoxy[1,1′-biphenyl]-4-ol is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and organic synthesis.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c1-16-13-8-9(6-7-12(13)15)10-4-2-3-5-11(10)14/h2-8,15H,1H3
InChI key:InChIKey=YGOPENVOCUYIPQ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1)C2=CC(OC)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-ol, 2′-fluoro-3-methoxy-
- 2′-Fluoro-3-methoxy[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.