
CAS 1261927-02-9
:3′,5-Difluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
Description:
3′,5-Difluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 3′ and 5′ positions and a hydroxyl group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents. This compound may exhibit interesting interactions in biological systems, potentially acting as a ligand or inhibitor in various biochemical pathways. Its fluorinated nature may also influence its reactivity and stability, making it a subject of interest in medicinal chemistry and material science. As with many fluorinated compounds, it may possess enhanced metabolic stability, which can be advantageous in drug development. Overall, 3′,5-Difluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid represents a versatile structure with potential applications in various fields.
Formula:C13H8F2O3
InChI:InChI=1S/C13H8F2O3/c14-8-2-3-9(13(17)18)10(6-8)7-1-4-12(16)11(15)5-7/h1-6,16H,(H,17,18)
InChI key:InChIKey=QYRVLCXAQBBTLG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(F)C=C1)C2=CC(F)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-2-carboxylic acid, 3′,5-difluoro-4′-hydroxy-
- 3′,5-Difluoro-4′-hydroxy[1,1′-biphenyl]-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.