
CAS 1261927-96-1
:2-Amino-5-[4-(1-piperidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid
Description:
2-Amino-5-[4-(1-piperidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, an amino group, and a carboxylic acid functional group. The presence of a piperidinylsulfonyl moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit polar characteristics due to the amino and carboxylic acid groups, which can engage in hydrogen bonding. Its sulfonamide group may enhance solubility in aqueous environments. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, making it a versatile candidate for further chemical modifications. Overall, 2-Amino-5-[4-(1-piperidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid represents a significant compound for research in pharmacology and organic synthesis.
Formula:C17H19N3O4S
InChI:InChI=1S/C17H19N3O4S/c18-16-15(17(21)22)10-13(11-19-16)12-4-6-14(7-5-12)25(23,24)20-8-2-1-3-9-20/h4-7,10-11H,1-3,8-9H2,(H2,18,19)(H,21,22)
InChI key:InChIKey=VNOBVWYOQNVTSU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1N)C2=CC=C(S(=O)(=O)N3CCCCC3)C=C2
Synonyms:- 2-Amino-5-[4-(1-piperidinylsulfonyl)phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 2-amino-5-[4-(1-piperidinylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.