CAS 1261928-30-6

4-Chloro-3-(5-formyl-3-thienyl)benzoic acid

Description:

4-Chloro-3-(5-formyl-3-thienyl)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chloro group and a thienyl group featuring an aldehyde functional group. The presence of the chloro substituent typically enhances the compound's reactivity and can influence its solubility and interaction with biological systems. The thienyl group, derived from thiophene, contributes to the compound's aromatic character and may impart unique electronic properties. This compound is likely to exhibit both acidic and electrophilic characteristics due to the carboxylic acid group and the aldehyde, respectively. Its potential applications may span across pharmaceuticals, agrochemicals, or materials science, particularly in the development of novel compounds with specific biological activities or as intermediates in synthetic pathways. The compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest in various chemical research fields.

Formula: C₁₂H₇ClO₃S

InChI: InChI=1S/C12H7ClO3S/c13-11-2-1-7(12(15)16)4-10(11)8-3-9(5-14)17-6-8/h1-6H,(H,15,16)

InChI key: InChIKey=UQTLKGXWIATCKE-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(O)=O)=CC1)C=2C=C(C=O)SC2

Synonyms:

• Benzoic acid, 4-chloro-3-(5-formyl-3-thienyl)-
• 4-Chloro-3-(5-formyl-3-thienyl)benzoic acid