CymitQuimica logo

CAS 1261928-35-1

:

2′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
2′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group at the 2′ position and a trifluoromethyl group at the 5 position significantly influences its chemical properties, including its reactivity and solubility. The carboxylic acid functional group at the 3 position contributes to its acidity and potential for hydrogen bonding, making it a polar compound. This substance is likely to exhibit unique electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its behavior in various chemical reactions. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or materials science, owing to its structural characteristics. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, making it important to consider these conditions in practical applications.
Formula:C15H11F3O2
InChI:InChI=1S/C15H11F3O2/c1-9-4-2-3-5-13(9)10-6-11(14(19)20)8-12(7-10)15(16,17)18/h2-8H,1H3,(H,19,20)
InChI key:InChIKey=VAJZEFPDUUKPEV-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(C(F)(F)F)=CC(C(O)=O)=C2)C=CC=C1
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 2′-methyl-5-(trifluoromethyl)-
  • 2′-Methyl-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.