CAS 1261928-84-0

5-Chloro-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol

Description:

5-Chloro-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with various functional groups. The presence of a hydroxyl group (-OH) at the 3-position contributes to its potential as a phenolic compound, influencing its reactivity and solubility in polar solvents. The trifluoromethyl group (-CF3) at the 3′ position enhances the compound's lipophilicity and may affect its biological activity, while the chloro (-Cl) and fluoro (-F) substituents introduce additional electronic effects that can modulate its chemical properties. This compound may exhibit interesting pharmacological activities due to its unique substitution pattern, making it a subject of interest in medicinal chemistry. Its CAS number, 1261928-84-0, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, the combination of halogen and hydroxyl functionalities suggests potential applications in diverse chemical reactions and biological systems.

Formula: C₁₃H₇ClF₄O

InChI: InChI=1S/C13H7ClF4O/c14-8-4-7(5-9(19)6-8)10-2-1-3-11(12(10)15)13(16,17)18/h1-6,19H

InChI key: InChIKey=DDJMULIYPIOYPP-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C(=CC=C1)C2=CC(Cl)=CC(O)=C2

Synonyms:

• 5-Chloro-2′-fluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-3-ol
• [1,1′-Biphenyl]-3-ol, 5-chloro-2′-fluoro-3′-(trifluoromethyl)-