
CAS 1261929-60-5
:3′,4′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol
Description:
3′,4′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol is an organic compound characterized by the presence of two chlorine atoms and a nitro group attached to a biphenyl structure, along with a hydroxyl group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond. The chlorine substituents are located at the 3' and 4' positions of one of the phenyl rings, while the nitro group is positioned at the 3 position of the other ring. The hydroxyl group is located at the 4 position of the same ring as the nitro group. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as potential biological activity and environmental persistence. Its structure suggests it may participate in various chemical reactions, including electrophilic substitution and nucleophilic attack, due to the presence of electron-withdrawing groups. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, making it of interest in both synthetic chemistry and potential applications in materials science or pharmaceuticals.
Formula:C12H7Cl2NO3
InChI:InChI=1S/C12H7Cl2NO3/c13-9-3-1-7(5-10(9)14)8-2-4-12(16)11(6-8)15(17)18/h1-6,16H
InChI key:InChIKey=HITJVZIYERIIPX-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1O)C2=CC(Cl)=C(Cl)C=C2
Synonyms:- 3′,4′-Dichloro-3-nitro[1,1′-biphenyl]-4-ol
- [1,1′-Biphenyl]-4-ol, 3′,4′-dichloro-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.