CAS 1261929-63-8

3′-Chloro-5′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:

3′-Chloro-5′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating a proton in solution. The compound features a chlorine atom and a nitro group (-NO2) as substituents on the biphenyl framework, which can influence its reactivity and polarity. The methyl group (-CH3) adds to the hydrophobic character of the molecule. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical or agrochemical research. Its specific interactions, solubility, and stability would depend on the surrounding conditions, including pH and solvent polarity. Overall, the unique combination of functional groups and structural features contributes to its chemical behavior and potential applications in various fields.

Formula: C₁₄H₁₀ClNO₄

InChI: InChI=1S/C14H10ClNO4/c1-8-4-9(6-10(15)5-8)13-7-11(16(19)20)2-3-12(13)14(17)18/h2-7H,1H3,(H,17,18)

InChI key: InChIKey=GKAQWJNUDAFJPN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC(C)=CC(Cl)=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 3′-chloro-5′-methyl-5-nitro-
• 3′-Chloro-5′-methyl-5-nitro[1,1′-biphenyl]-2-carboxylic acid