CAS 1261929-73-0

3-(4-Formylphenyl)-4-pyridinecarboxylic acid

Description:

3-(4-Formylphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1261929-73-0, is an organic compound characterized by the presence of both a pyridine and an aromatic aldehyde functional group. This compound features a pyridine ring substituted with a carboxylic acid group and a phenyl group that contains an aldehyde functional group at the para position. The presence of these functional groups suggests that the compound may exhibit properties such as acidity due to the carboxylic acid and potential reactivity due to the aldehyde. It may also participate in various chemical reactions, including condensation and substitution reactions, making it useful in organic synthesis. Additionally, the compound's structure may allow for interactions such as hydrogen bonding, influencing its solubility and reactivity in different solvents. Overall, 3-(4-Formylphenyl)-4-pyridinecarboxylic acid is of interest in fields such as medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules.

Formula: C₁₃H₉NO₃

InChI: InChI=1S/C13H9NO3/c15-8-9-1-3-10(4-2-9)12-7-14-6-5-11(12)13(16)17/h1-8H,(H,16,17)

InChI key: InChIKey=DLINIYBSUSWTSV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CN=CC1)C2=CC=C(C=O)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 3-(4-formylphenyl)-
• 3-(4-Formylphenyl)-4-pyridinecarboxylic acid