CAS 1261930-52-2

2-Chloro-5-[2-fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:

2-Chloro-5-[2-fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. The presence of a chloro group and a fluoro group indicates that it is a halogenated compound, which can influence its reactivity and biological activity. The methoxycarbonyl group suggests that it can participate in esterification reactions, making it useful in organic synthesis. This compound is likely to exhibit polar characteristics due to the carboxylic acid and methoxycarbonyl functionalities, which can affect its solubility in various solvents. Additionally, the presence of multiple aromatic rings may contribute to its stability and potential interactions with biological targets. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and material science, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₁₄H₉ClFNO₄

InChI: InChI=1S/C14H9ClFNO4/c1-21-14(20)7-2-3-11(16)9(4-7)8-5-10(13(18)19)12(15)17-6-8/h2-6H,1H3,(H,18,19)

InChI key: InChIKey=PJUWDFQMOCFBOP-UHFFFAOYSA-N

SMILES: FC=1C(C=2C=C(C(O)=O)C(Cl)=NC2)=CC(C(OC)=O)=CC1

Synonyms:

• 3-Pyridinecarboxylic acid, 2-chloro-5-[2-fluoro-5-(methoxycarbonyl)phenyl]-
• 2-Chloro-5-[2-fluoro-5-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid