CAS 1261930-65-7

5′-Chloro-3-hydroxy-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid

Description:

5′-Chloro-3-hydroxy-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 5′ position and a hydroxy group at the 3 position, along with a methoxy group at the 2′ position, contributes to its unique chemical properties. The carboxylic acid functional group at the 4 position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. This compound may exhibit biological activity due to its structural features, which could influence interactions with biological targets. Its solubility and stability in different solvents can vary based on the functional groups present. Overall, the compound's characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research and testing.

Formula: C₁₄H₁₁ClO₄

InChI: InChI=1S/C14H11ClO4/c1-19-13-5-3-9(15)7-11(13)8-2-4-10(14(17)18)12(16)6-8/h2-7,16H,1H3,(H,17,18)

InChI key: InChIKey=UKSQAFXXSGFMKQ-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(Cl)C=C1)C2=CC(O)=C(C(O)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 5′-chloro-3-hydroxy-2′-methoxy-
• 5′-Chloro-3-hydroxy-2′-methoxy[1,1′-biphenyl]-4-carboxylic acid