
CAS 1261930-87-3
:3-[3-Fluoro-5-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid
Description:
3-[3-Fluoro-5-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid, identified by its CAS number 1261930-87-3, is a chemical compound characterized by its complex structure that includes a pyridine ring and a phenyl group with a fluorine substituent and a methoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of functional groups. The fluorine atom can enhance lipophilicity and influence the compound's biological activity, while the methoxycarbonyl group may participate in various chemical reactions, including esterification and nucleophilic substitution. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and structural features that allow for further modifications.
Formula:C14H10FNO4
InChI:InChI=1S/C14H10FNO4/c1-20-14(19)9-4-8(5-10(15)6-9)12-7-16-3-2-11(12)13(17)18/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=PMHFSLAZNGHWAT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=CC(C(OC)=O)=CC(F)=C2
Synonyms:- 4-Pyridinecarboxylic acid, 3-[3-fluoro-5-(methoxycarbonyl)phenyl]-
- 3-[3-Fluoro-5-(methoxycarbonyl)phenyl]-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.