CymitQuimica logo

CAS 1261931-45-6

:

5-Nitro[1,1′-biphenyl]-3,4′-dicarboxylic acid

Description:
5-Nitro[1,1′-biphenyl]-3,4′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of nitro and carboxylic acid functional groups significantly influences its chemical properties. The nitro group, being an electron-withdrawing group, enhances the acidity of the carboxylic acid groups, making the compound more reactive in electrophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid groups. Its potential applications may include use in organic synthesis, as a building block for more complex molecules, or in materials science due to its unique structural features. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other substituents or solvents. Safety data should be consulted for handling and storage, as compounds with nitro groups can be sensitive and potentially hazardous.
Formula:C14H9NO6
InChI:InChI=1S/C14H9NO6/c16-13(17)9-3-1-8(2-4-9)10-5-11(14(18)19)7-12(6-10)15(20)21/h1-7H,(H,16,17)(H,18,19)
InChI key:InChIKey=IMMMKRJSBMQYKG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC=C(C(O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 5-nitro-
  • 5-Nitro[1,1′-biphenyl]-3,4′-dicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.