
CAS 1261931-57-0
:(4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-1-pyrrolidinylmethanone
Description:
The chemical substance known as (4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-1-pyrrolidinylmethanone, with the CAS number 1261931-57-0, is a synthetic compound that features a biphenyl structure substituted with hydroxy and methoxy groups, along with a pyrrolidinylmethanone moiety. This compound is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in medicinal chemistry and pharmacology. The presence of the hydroxyl and methoxy groups suggests that it may exhibit hydrogen bonding capabilities and lipophilicity, influencing its solubility and permeability. Additionally, the pyrrolidinyl group may contribute to its pharmacokinetic properties. As with many synthetic organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is studied, including pH, temperature, and the presence of other chemical species. Further research would be necessary to fully elucidate its properties and potential uses in various fields, including drug development and materials science.
Formula:C18H19NO3
InChI:InChI=1S/C18H19NO3/c1-22-17-12-14(7-8-16(17)20)13-5-4-6-15(11-13)18(21)19-9-2-3-10-19/h4-8,11-12,20H,2-3,9-10H2,1H3
InChI key:InChIKey=PUQLXGOPPLTCMG-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1O)C2=CC(C(=O)N3CCCC3)=CC=C2
Synonyms:- (4′-Hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-1-pyrrolidinylmethanone
- Methanone, (4′-hydroxy-3′-methoxy[1,1′-biphenyl]-3-yl)-1-pyrrolidinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.