CymitQuimica logo

CAS 1261931-88-7

:

5-Amino-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid

Description:
5-Amino-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid, identified by its CAS number 1261931-88-7, is an organic compound characterized by the presence of an amino group, a hydroxyl group, and a carboxylic acid functional group attached to a biphenyl structure. This compound typically exhibits properties such as solubility in polar solvents due to its functional groups, which can engage in hydrogen bonding. The amino group contributes to its basicity, while the carboxylic acid group imparts acidic characteristics. The hydroxyl group enhances its reactivity and potential for forming esters or ethers. In terms of applications, compounds with similar structures are often explored in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The biphenyl framework may also influence its electronic properties, making it of interest in materials science and dye chemistry. Overall, 5-Amino-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C13H11NO3
InChI:InChI=1S/C13H11NO3/c14-11-6-9(5-10(7-11)13(16)17)8-1-3-12(15)4-2-8/h1-7,15H,14H2,(H,16,17)
InChI key:InChIKey=DHBSJSOFGSANII-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N)C1)C2=CC=C(O)C=C2
Synonyms:
  • 5-Amino-4′-hydroxy[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-4′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.