CAS 1261932-66-4

4-(3-Carboxyphenyl)-2-thiophenecarboxylic acid

Description:

4-(3-Carboxyphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its dual carboxylic acid functional groups and a thiophene ring. This compound features a phenyl group substituted with a carboxylic acid at the para position relative to a thiophene ring, which itself is also substituted with a carboxylic acid group. The presence of these functional groups contributes to its acidity and potential for forming hydrogen bonds, influencing its solubility and reactivity. The thiophene ring adds to the compound's aromaticity and can participate in various chemical reactions, such as electrophilic substitution. This compound may exhibit interesting properties such as fluorescence or photostability, making it of interest in materials science and organic synthesis. Additionally, its structural characteristics suggest potential applications in pharmaceuticals or as a building block in organic synthesis. Overall, the unique combination of functional groups and aromatic systems in 4-(3-Carboxyphenyl)-2-thiophenecarboxylic acid makes it a compound of interest in various chemical research fields.

Formula: C₁₂H₈O₄S

InChI: InChI=1S/C12H8O4S/c13-11(14)8-3-1-2-7(4-8)9-5-10(12(15)16)17-6-9/h1-6H,(H,13,14)(H,15,16)

InChI key: InChIKey=GGOBMZCKLUNCCR-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CS1)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 4-(3-Carboxyphenyl)-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 4-(3-carboxyphenyl)-