CAS 1261933-34-9

3-(5-Formyl-3-thienyl)-5-(trifluoromethyl)benzoic acid

Description:

3-(5-Formyl-3-thienyl)-5-(trifluoromethyl)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with both a trifluoromethyl group and a thienyl group containing an aldehyde functional group. The presence of the trifluoromethyl group typically imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. The thienyl ring contributes to the compound's aromatic character and may participate in various chemical interactions. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic trifluoromethyl group, while the carboxylic acid functional group can engage in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the aldehyde functionality may allow for further chemical transformations, making it a versatile intermediate in organic synthesis. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and characterization.

Formula: C₁₃H₇F₃O₃S

InChI: InChI=1S/C13H7F3O3S/c14-13(15,16)10-2-7(1-8(3-10)12(18)19)9-4-11(5-17)20-6-9/h1-6H,(H,18,19)

InChI key: InChIKey=ATWLPMICNWNOTE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C=2C=C(C=O)SC2

Synonyms:

• Benzoic acid, 3-(5-formyl-3-thienyl)-5-(trifluoromethyl)-
• 3-(5-Formyl-3-thienyl)-5-(trifluoromethyl)benzoic acid