
CAS 1261933-40-7
:4-Fluoro[1,1′-biphenyl]-2,4′-diol
Description:
4-Fluoro[1,1′-biphenyl]-2,4′-diol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 4-position of one phenyl ring and hydroxyl groups (-OH) at the 2 and 4′ positions contributes to its chemical properties and reactivity. This compound is likely to exhibit polar characteristics due to the hydroxyl groups, which can engage in hydrogen bonding, influencing its solubility in various solvents. The fluorine substitution can also affect the electronic properties of the molecule, potentially enhancing its stability and altering its reactivity compared to non-fluorinated analogs. Additionally, 4-Fluoro[1,1′-biphenyl]-2,4′-diol may have applications in pharmaceuticals or materials science, although specific uses would depend on further research into its biological activity and physical properties. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C12H9FO2
InChI:InChI=1S/C12H9FO2/c13-9-3-6-11(12(15)7-9)8-1-4-10(14)5-2-8/h1-7,14-15H
InChI key:InChIKey=ZYHOLJVCWPMXFE-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC=C(O)C=C2)C=CC(F)=C1
Synonyms:- 4-Fluoro[1,1′-biphenyl]-2,4′-diol
- [1,1′-Biphenyl]-2,4′-diol, 4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.