CymitQuimica logo

CAS 1261933-58-7

:

4-[3-Hydroxy-5-(trifluoromethoxy)phenyl]-2-thiophenecarboxylic acid

Description:
4-[3-Hydroxy-5-(trifluoromethoxy)phenyl]-2-thiophenecarboxylic acid, identified by its CAS number 1261933-58-7, is a chemical compound that features a thiophene ring and a phenolic structure with a trifluoromethoxy substituent. This compound is characterized by its potential biological activity, which may include anti-inflammatory or antimicrobial properties, owing to the presence of the hydroxyl group and the electron-withdrawing trifluoromethoxy group that can influence its reactivity and solubility. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, the presence of fluorine atoms typically enhances the lipophilicity and metabolic stability of organic compounds, which can be advantageous in pharmaceutical applications. The compound's structural features suggest it may interact with biological targets, making it of interest in medicinal chemistry. However, specific properties such as melting point, solubility, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C12H7F3O4S
InChI:InChI=1S/C12H7F3O4S/c13-12(14,15)19-9-2-6(1-8(16)4-9)7-3-10(11(17)18)20-5-7/h1-5,16H,(H,17,18)
InChI key:InChIKey=UTBNUSBYXXNFRC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CS1)C2=CC(OC(F)(F)F)=CC(O)=C2
Synonyms:
  • 2-Thiophenecarboxylic acid, 4-[3-hydroxy-5-(trifluoromethoxy)phenyl]-
  • 4-[3-Hydroxy-5-(trifluoromethoxy)phenyl]-2-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.