
CAS 1261933-71-4
:2′,5′-Dimethoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
Description:
2′,5′-Dimethoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple functional groups, including two methoxy (-OCH3) groups and a trifluoromethoxy (-OCF3) group, which contribute to its unique chemical properties and potential reactivity. The presence of the hydroxyl (-OH) group at the 3-position of the biphenyl framework enhances its polarity and solubility in polar solvents. The trifluoromethoxy group introduces significant electronegativity, which can influence the compound's electronic properties and interactions with biological targets. This compound may exhibit interesting pharmacological activities due to its structural characteristics, making it a subject of interest in medicinal chemistry and materials science. Its specific applications and behavior would depend on further studies, including its synthesis, stability, and interactions with other chemical entities.
Formula:C15H13F3O4
InChI:InChI=1S/C15H13F3O4/c1-20-11-3-4-14(21-2)13(8-11)9-5-10(19)7-12(6-9)22-15(16,17)18/h3-8,19H,1-2H3
InChI key:InChIKey=OGDIQQROBARYEI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2=CC(OC(F)(F)F)=CC(O)=C2)C=C(OC)C=C1
Synonyms:- 2′,5′-Dimethoxy-5-(trifluoromethoxy)[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 2′,5′-dimethoxy-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.