CymitQuimica logo

CAS 1261933-86-1

:

3′-Hydroxy-5′-methyl[1,1′-biphenyl]-4-methanol

Description:
3′-Hydroxy-5′-methyl[1,1′-biphenyl]-4-methanol, identified by its CAS number 1261933-86-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, which may influence its solubility in various solvents and its interaction with biological systems. Additionally, the methyl group can affect the compound's steric properties and overall stability. This substance may be of interest in fields such as organic synthesis, materials science, or medicinal chemistry, where modifications to biphenyl derivatives can lead to novel properties or biological activities. However, specific data regarding its physical properties, reactivity, and applications would require further investigation or experimental analysis.
Formula:C14H14O2
InChI:InChI=1S/C14H14O2/c1-10-6-13(8-14(16)7-10)12-4-2-11(9-15)3-5-12/h2-8,15-16H,9H2,1H3
InChI key:InChIKey=XLRXEDDLDBIGQJ-UHFFFAOYSA-N
SMILES:CC=1C=C(C=C(O)C1)C2=CC=C(CO)C=C2
Synonyms:
  • 3′-Hydroxy-5′-methyl[1,1′-biphenyl]-4-methanol
  • [1,1′-Biphenyl]-4-methanol, 3′-hydroxy-5′-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.