CAS 1261934-71-7

4-(1,2-Dihydro-2-oxo-5-pyrimidinyl)-2-thiophenecarboxylic acid

Description:

4-(1,2-Dihydro-2-oxo-5-pyrimidinyl)-2-thiophenecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring fused with a thiophene moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and solubility in various organic solvents. The presence of the carboxylic acid functional group suggests it may exhibit acidic properties, influencing its reactivity and interactions with other molecules. Additionally, the diketone structure within the pyrimidine ring may contribute to its ability to participate in various chemical reactions, including condensation and substitution reactions. The compound's molecular structure may also suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.

Formula: C₉H₆N₂O₃S

InChI: InChI=1S/C9H6N2O3S/c12-8(13)7-1-5(4-15-7)6-2-10-9(14)11-3-6/h1-4H,(H,12,13)(H,10,11,14)

InChI key: InChIKey=HECYILFCMFSAEP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CS1)C2=CNC(=O)N=C2

Synonyms:

• 2-Thiophenecarboxylic acid, 4-(1,2-dihydro-2-oxo-5-pyrimidinyl)-
• 4-(1,2-Dihydro-2-oxo-5-pyrimidinyl)-2-thiophenecarboxylic acid