CAS 1261935-51-6

5-Amino-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Amino-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which features a carboxylic acid group and an amino group, along with a methylsulfonyl substituent. This compound is likely to exhibit both acidic and basic properties due to the presence of the carboxylic acid and amino groups, respectively. The methylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, such as coupling or substitution reactions. Its molecular weight, solubility, and stability under different conditions would be important factors to consider in practical applications. Overall, this compound represents a versatile structure with potential utility in medicinal chemistry and related fields.

Formula: C₁₄H₁₃NO₄S

InChI: InChI=1S/C14H13NO4S/c1-20(18,19)13-4-2-3-9(8-13)10-5-11(14(16)17)7-12(15)6-10/h2-8H,15H2,1H3,(H,16,17)

InChI key: InChIKey=FUXXYNYGXZBPBF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(N)C1)C2=CC(S(C)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-amino-3′-(methylsulfonyl)-
• 5-Amino-3′-(methylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid