CymitQuimica logo

CAS 1261935-54-9

:

2,2′,5′-Trifluoro[1,1′-biphenyl]-4-ol

Description:
2,2′,5′-Trifluoro[1,1′-biphenyl]-4-ol, identified by its CAS number 1261935-54-9, is a chemical compound characterized by the presence of three fluorine atoms and a hydroxyl group attached to a biphenyl structure. This compound exhibits significant hydrophobic properties due to the fluorinated groups, which can influence its solubility and reactivity in various solvents. The hydroxyl group contributes to its potential as a hydrogen bond donor, affecting its interactions in chemical reactions and biological systems. The trifluoromethyl groups enhance the compound's stability and can impart unique electronic properties, making it of interest in materials science and medicinal chemistry. Additionally, the presence of fluorine atoms often leads to increased lipophilicity, which can affect the compound's bioavailability and pharmacokinetics. Overall, 2,2′,5′-Trifluoro[1,1′-biphenyl]-4-ol is a versatile compound with applications in various fields, including pharmaceuticals and agrochemicals, due to its distinctive chemical characteristics.
Formula:C12H7F3O
InChI:InChI=1S/C12H7F3O/c13-7-1-4-11(14)10(5-7)9-3-2-8(16)6-12(9)15/h1-6,16H
InChI key:InChIKey=RIRUSYCWZYJSSZ-UHFFFAOYSA-N
SMILES:FC1=C(C=C(F)C=C1)C2=C(F)C=C(O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-ol, 2,2′,5′-trifluoro-
  • 2,2′,5′-Trifluoro[1,1′-biphenyl]-4-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.