
CAS 1261935-95-8
:5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid
Description:
5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of the 3,4-dimethoxyphenyl group contributes to its aromatic properties and may influence its reactivity and solubility. This compound is likely to exhibit both acidic and basic characteristics due to the carboxylic acid and the nitrogen atom in the pyridine ring, respectively. It may participate in various chemical reactions, including esterification and amidation, and could serve as a potential intermediate in organic synthesis. Additionally, the methoxy groups may enhance its lipophilicity, affecting its biological activity and interaction with other molecules. The compound's specific applications and biological properties would depend on further studies, including pharmacological evaluations, which could reveal its potential as a therapeutic agent or in other chemical applications.
Formula:C14H13NO5
InChI:InChI=1S/C14H13NO5/c1-19-11-4-3-8(6-12(11)20-2)9-5-10(14(17)18)13(16)15-7-9/h3-7H,1-2H3,(H,15,16)(H,17,18)
InChI key:InChIKey=ARFAZYBWHPXSOG-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C=2C=C(C(O)=O)C(=O)NC2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(3,4-dimethoxyphenyl)-1,2-dihydro-2-oxo-
- 5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.