CymitQuimica logo

CAS 1261935-98-1

:

2-[4-Chloro-3-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid

Description:
2-[4-Chloro-3-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a chloro and a methoxycarbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The chloro substituent can influence its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The methoxycarbonyl group introduces a carboxylic acid functionality, which can participate in acid-base reactions and may enhance solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular interactions, such as hydrogen bonding and π-π stacking, can also play a significant role in its behavior in different environments. Overall, this compound's unique structural features contribute to its potential applications in organic synthesis and medicinal chemistry.
Formula:C14H10ClNO4
InChI:InChI=1S/C14H10ClNO4/c1-20-14(19)10-7-8(4-5-11(10)15)12-9(13(17)18)3-2-6-16-12/h2-7H,1H3,(H,17,18)
InChI key:InChIKey=LVRPHTOFTUUNLO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)C2=CC(C(OC)=O)=C(Cl)C=C2
Synonyms:
  • 2-[4-Chloro-3-(methoxycarbonyl)phenyl]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-[4-chloro-3-(methoxycarbonyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.