CAS 1261936-18-8

4-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid

Description:

4-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which features a methoxy group and a carboxylic acid functional group. The presence of the pyrrolidinylcarbonyl moiety indicates that it has a nitrogen-containing heterocyclic component, which may contribute to its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the biphenyl and methoxy groups, which can influence its solubility and permeability in biological systems. The carboxylic acid group provides acidic properties, allowing for potential interactions with biological targets through hydrogen bonding or ionic interactions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with specific biological pathways. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₉H₁₉NO₄

InChI: InChI=1S/C19H19NO4/c1-24-15-7-8-16(17(12-15)19(22)23)13-5-4-6-14(11-13)18(21)20-9-2-3-10-20/h4-8,11-12H,2-3,9-10H2,1H3,(H,22,23)

InChI key: InChIKey=ACLPFZUGDUDSGK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(OC)=C1)C2=CC(C(=O)N3CCCC3)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-2-carboxylic acid, 4-methoxy-3′-(1-pyrrolidinylcarbonyl)-
• 4-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-2-carboxylic acid