CAS 1261936-58-6

4′-Chloro-5-nitro[1,1′-biphenyl]-2,3′-dicarboxylic acid

Description:

4′-Chloro-5-nitro[1,1′-biphenyl]-2,3′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a chlorine atom and a nitro group attached to the biphenyl framework, contributing to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of two carboxylic acid groups (-COOH) indicates that it can participate in acid-base reactions and may act as a ligand in coordination chemistry. Its molecular structure suggests that it may exhibit interesting properties such as solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid groups. Additionally, the chlorine and nitro substituents can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological systems. Overall, this compound's unique functional groups and structural features make it a subject of interest for further research and application development.

Formula: C₁₄H₈ClNO₆

InChI: InChI=1S/C14H8ClNO6/c15-12-4-1-7(5-11(12)14(19)20)10-6-8(16(21)22)2-3-9(10)13(17)18/h1-6H,(H,17,18)(H,19,20)

InChI key: InChIKey=WGKILKJQYKGMNB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=CC(C(O)=O)=C(Cl)C=C2

Synonyms:

• [1,1′-Biphenyl]-2,3′-dicarboxylic acid, 4′-chloro-5-nitro-
• 4′-Chloro-5-nitro[1,1′-biphenyl]-2,3′-dicarboxylic acid