
CAS 1261937-32-9
:4-(2,4-Difluorophenyl)-2(1H)-pyridinone
Description:
4-(2,4-Difluorophenyl)-2(1H)-pyridinone, identified by its CAS number 1261937-32-9, is an organic compound characterized by its unique molecular structure, which includes a pyridinone core substituted with a difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the pyridinone moiety. It may display moderate to high solubility in organic solvents, while its solubility in water can vary based on pH and other conditions. The difluorophenyl substituent can influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological targets. Additionally, the presence of fluorine atoms often enhances lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry and drug development. Overall, 4-(2,4-Difluorophenyl)-2(1H)-pyridinone represents a class of compounds that may have applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C11H7F2NO
InChI:InChI=1S/C11H7F2NO/c12-8-1-2-9(10(13)6-8)7-3-4-14-11(15)5-7/h1-6H,(H,14,15)
InChI key:InChIKey=AJUWFVBWTKMYTM-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(=O)NC=C2)C=CC(F)=C1
Synonyms:- 4-(2,4-Difluorophenyl)-2(1H)-pyridinone
- 2(1H)-Pyridinone, 4-(2,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.