CymitQuimica logo

CAS 1261937-38-5

:

6-(1,3-Benzodioxol-5-yl)-3-pyridinol

Description:
6-(1,3-Benzodioxol-5-yl)-3-pyridinol, identified by its CAS number 1261937-38-5, is an organic compound characterized by the presence of a pyridine ring and a benzodioxole moiety. The structure features a hydroxyl group (-OH) attached to the pyridine ring, which contributes to its potential as a ligand in coordination chemistry and its biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular framework suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The presence of the benzodioxole unit may also impart unique electronic properties, enhancing its reactivity and solubility in organic solvents. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 6-(1,3-Benzodioxol-5-yl)-3-pyridinol represents a versatile structure with potential applications in drug development and chemical research.
Formula:C12H9NO3
InChI:InChI=1S/C12H9NO3/c14-9-2-3-10(13-6-9)8-1-4-11-12(5-8)16-7-15-11/h1-6,14H,7H2
InChI key:InChIKey=QKQSXORVHIODCJ-UHFFFAOYSA-N
SMILES:OC1=CC=C(C=2C=C3C(=CC2)OCO3)N=C1
Synonyms:
  • 3-Pyridinol, 6-(1,3-benzodioxol-5-yl)-
  • 6-(1,3-Benzodioxol-5-yl)-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.