CymitQuimica logo

CAS 1261937-46-5

:

3-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid

Description:
3-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The compound features a chloro substituent and a methoxy group (-OCH3) on the biphenyl framework, which can influence its reactivity and solubility. Additionally, the trifluoromethyl group (-CF3) is known for imparting unique electronic properties, enhancing lipophilicity, and potentially affecting biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its specific interactions and applications would depend on the context of its use, including potential roles in drug development or as a chemical intermediate.
Formula:C15H10ClF3O3
InChI:InChI=1S/C15H10ClF3O3/c1-22-13-5-3-8(6-11(13)15(17,18)19)9-2-4-10(14(20)21)12(16)7-9/h2-7H,1H3,(H,20,21)
InChI key:InChIKey=DNCKXPSYPUAJBX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(OC)C=CC(=C1)C2=CC(Cl)=C(C(O)=O)C=C2
Synonyms:
  • 3-Chloro-4′-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid
  • [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-4′-methoxy-3′-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.