CAS 1261937-55-6

5-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid

Description:

5-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a phenyl group substituted with both a fluorine atom and a trifluoromethyl group. This compound is likely to exhibit polar characteristics due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding. The trifluoromethyl group contributes to its lipophilicity and may influence its reactivity and interaction with biological targets. The fluorine substituents can enhance the compound's metabolic stability and alter its pharmacokinetic properties. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as solubility, melting point, and reactivity, would depend on the overall molecular interactions and the environment in which it is studied. Further investigation through experimental methods would provide a comprehensive understanding of its behavior and potential applications.

Formula: C₁₄H₉F₄NO₃

InChI: InChI=1S/C14H9F4NO3/c1-22-12-9(13(20)21)5-7(6-19-12)8-3-2-4-10(11(8)15)14(16,17)18/h2-6H,1H3,(H,20,21)

InChI key: InChIKey=HBNFQODLZGMXLB-UHFFFAOYSA-N

SMILES: FC1=C(C=2C=C(C(O)=O)C(OC)=NC2)C=CC=C1C(F)(F)F

Synonyms:

• 5-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-methoxy-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-[2-fluoro-3-(trifluoromethyl)phenyl]-2-methoxy-