CymitQuimica logo

CAS 1261937-57-8

:

5-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:
5-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a methoxy group, a carboxylic acid functional group, and a piperidinylsulfonyl moiety. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups present. The presence of the carboxylic acid group suggests potential acidity, while the methoxy group can influence the compound's polarity and reactivity. The piperidinylsulfonyl group may impart specific biological activity, making this compound of interest in medicinal chemistry. Its unique structure could lead to interactions with biological targets, potentially making it useful in pharmaceutical applications. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of other chemicals.
Formula:C19H21NO5S
InChI:InChI=1S/C19H21NO5S/c1-25-17-12-15(11-16(13-17)19(21)22)14-5-7-18(8-6-14)26(23,24)20-9-3-2-4-10-20/h5-8,11-13H,2-4,9-10H2,1H3,(H,21,22)
InChI key:InChIKey=ZWERXYMFJPJFCX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(OC)C1)C2=CC=C(S(=O)(=O)N3CCCCC3)C=C2
Synonyms:
  • 5-Methoxy-4′-(1-piperidinylsulfonyl)[1,1′-biphenyl]-3-carboxylic acid
  • [1,1′-Biphenyl]-3-carboxylic acid, 5-methoxy-4′-(1-piperidinylsulfonyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.