
CAS 1261938-21-9
:3-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone
Description:
3-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone, identified by its CAS number 1261938-21-9, is an organic compound characterized by its unique molecular structure, which includes a pyridinone core substituted with a chloro and a methyl group on the phenyl ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the pyridinone moiety. It may display moderate solubility in organic solvents, while its solubility in water can vary depending on the specific conditions. The presence of the chloro substituent can influence its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Overall, the characteristics of 3-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone suggest it could be a valuable compound for further research in various chemical and pharmaceutical applications.
Formula:C12H10ClNO
InChI:InChI=1S/C12H10ClNO/c1-8-4-5-9(11(13)7-8)10-3-2-6-14-12(10)15/h2-7H,1H3,(H,14,15)
InChI key:InChIKey=YAPOSOCHGYPPID-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC(C)=C1)C=2C(=O)NC=CC2
Synonyms:- 2(1H)-Pyridinone, 3-(2-chloro-4-methylphenyl)-
- 3-(2-Chloro-4-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.