CAS 1261938-35-5

2′-Fluoro-2-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

2′-Fluoro-2-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a fluoro group, a trifluoromethyl group, and a carboxylic acid functional group. The presence of the fluoro and trifluoromethyl groups contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The carboxylic acid group imparts acidic characteristics, allowing for potential interactions with bases and other nucleophiles. This compound may exhibit interesting biological activity due to its structural features, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of multiple fluorine atoms can influence the compound's lipophilicity and metabolic stability. Overall, 2′-Fluoro-2-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a fluorinated aromatic compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₅H₁₀F₄O₂

InChI: InChI=1S/C15H10F4O2/c1-8-9(4-2-5-10(8)14(20)21)11-6-3-7-12(13(11)16)15(17,18)19/h2-7H,1H3,(H,20,21)

InChI key: InChIKey=GHZSYIAPYGELQR-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(F)C(=CC=C1)C2=C(C)C(C(O)=O)=CC=C2

Synonyms:

• 2′-Fluoro-2-methyl-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 2′-fluoro-2-methyl-3′-(trifluoromethyl)-