CAS 1261938-48-0

2,2′-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

2,2′-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid is a fluorinated organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 2′ positions, along with a trifluoromethyl group at the 3′ position, significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The carboxylic acid functional group at the 4 position contributes to its acidity and solubility in polar solvents. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique electronic properties and potential applications in drug design and synthesis. Its fluorinated nature may enhance metabolic stability and bioavailability in biological systems. Additionally, the compound's structural features may allow for specific interactions with biological targets, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all fluorinated compounds, due to their potential environmental and health impacts.

Formula: C₁₄H₇F₅O₂

InChI: InChI=1S/C14H7F5O2/c15-11-6-7(13(20)21)4-5-8(11)9-2-1-3-10(12(9)16)14(17,18)19/h1-6H,(H,20,21)

InChI key: InChIKey=KYRDTOAPRZIBOV-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1C(F)(F)F)C2=C(F)C=C(C(O)=O)C=C2

Synonyms:

• 2,2′-Difluoro-3′-(trifluoromethyl)[1,1′-biphenyl]-4-carboxylic acid
• [1,1′-Biphenyl]-4-carboxylic acid, 2,2′-difluoro-3′-(trifluoromethyl)-