
CAS 1261938-68-4
:2′-Fluoro-5-nitro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-carboxylic acid
Description:
2′-Fluoro-5-nitro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl backbone substituted with various functional groups. The presence of a fluoro group, a nitro group, and a trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. The trifluoromethyl group is known for enhancing the compound's metabolic stability and lipophilicity, making it of interest in pharmaceutical applications. Additionally, the nitro group can participate in various chemical reactions, including reduction and nucleophilic substitution. The compound's molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of biologically active molecules. Its specific interactions and reactivity would depend on the surrounding environment and the presence of other functional groups.
Formula:C14H7F4NO4
InChI:InChI=1S/C14H7F4NO4/c15-12-8(2-1-3-11(12)14(16,17)18)10-6-7(19(22)23)4-5-9(10)13(20)21/h1-6H,(H,20,21)
InChI key:InChIKey=RBQDVBCCNAMTCN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=C(N(=O)=O)C=C1)C2=C(F)C(C(F)(F)F)=CC=C2
Synonyms:- 2′-Fluoro-5-nitro-3′-(trifluoromethyl)[1,1′-biphenyl]-2-carboxylic acid
- [1,1′-Biphenyl]-2-carboxylic acid, 2′-fluoro-5-nitro-3′-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.