
CAS 1261938-73-1
:4-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone
Description:
4-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone, identified by its CAS number 1261938-73-1, is an organic compound characterized by its unique molecular structure, which includes a pyridinone core substituted with an ethoxy and a methylphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the pyridinone moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the ethoxy group can influence its solubility and reactivity, making it potentially useful in medicinal chemistry and material science. The compound's specific interactions and applications would depend on its precise molecular configuration and the functional groups present, which could affect its pharmacological properties and efficacy in biological systems. Overall, 4-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone represents a class of compounds that may have significant implications in research and development within various chemical and pharmaceutical fields.
Formula:C14H15NO2
InChI:InChI=1S/C14H15NO2/c1-3-17-12-4-5-13(10(2)8-12)11-6-7-15-14(16)9-11/h4-9H,3H2,1-2H3,(H,15,16)
InChI key:InChIKey=PHHZOZPJDSOWTI-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC(=O)NC=C2)C=CC(OCC)=C1
Synonyms:- 2(1H)-Pyridinone, 4-(4-ethoxy-2-methylphenyl)-
- 4-(4-Ethoxy-2-methylphenyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.