CAS 1261938-86-6

2-(3-Chloro-4-methoxyphenyl)-4-pyridinol

Description:

2-(3-Chloro-4-methoxyphenyl)-4-pyridinol, identified by its CAS number 1261938-86-6, is a chemical compound that features a pyridine ring substituted with a phenyl group containing both a chlorine atom and a methoxy group. This compound exhibits characteristics typical of both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the chloro and methoxy substituents can influence its solubility, reactivity, and interaction with biological targets. Generally, compounds of this nature may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on further empirical studies. The molecular structure suggests that it may participate in hydrogen bonding due to the hydroxyl group, enhancing its potential as a pharmacophore. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-(3-Chloro-4-methoxyphenyl)-4-pyridinol represents a class of compounds that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₂H₁₀ClNO₂

InChI: InChI=1S/C12H10ClNO2/c1-16-12-3-2-8(6-10(12)13)11-7-9(15)4-5-14-11/h2-7H,1H3,(H,14,15)

InChI key: InChIKey=AFCOKRKZVNDSAV-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1OC)C2=CC(O)=CC=N2

Synonyms:

• 2-(3-Chloro-4-methoxyphenyl)-4-pyridinol
• 4-Pyridinol, 2-(3-chloro-4-methoxyphenyl)-