
CAS 1261939-01-8
:4-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
Description:
4-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid, identified by its CAS number 1261939-01-8, is an organic compound characterized by its complex structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group contributes to its acidity and potential for hydrogen bonding, which can affect solubility and interaction with other molecules. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can be beneficial in various applications, including agrochemicals and medicinal chemistry. Overall, this compound's characteristics make it a subject of interest for further studies in chemical synthesis and biological evaluation.
Formula:C13H8F3NO2
InChI:InChI=1S/C13H8F3NO2/c14-13(15,16)11-4-2-1-3-9(11)8-5-6-17-7-10(8)12(18)19/h1-7H,(H,18,19)
InChI key:InChIKey=HBBNTAUUONDZRE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C=2C(C(O)=O)=CN=CC2
Synonyms:- 4-[2-(Trifluoromethyl)phenyl]-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 4-[2-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.