CAS 1261939-10-9

3′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a hydroxymethyl group (-CH2OH) at the 3' position and a carboxylic acid group (-COOH) at the 3 position contributes to its reactivity and solubility in polar solvents. The methyl group at the 2 position influences its steric properties and can affect its interaction with biological systems. This compound may exhibit various functional properties, including potential applications in pharmaceuticals or as a building block in organic synthesis. Its molecular structure allows for hydrogen bonding due to the hydroxymethyl and carboxylic acid groups, which can enhance its solubility in water and other polar solvents. Additionally, the biphenyl moiety may impart unique electronic properties, making it of interest in materials science and organic electronics. Overall, this compound's characteristics make it a subject of interest in various fields of chemical research.

Formula: C₁₅H₁₄O₃

InChI: InChI=1S/C15H14O3/c1-10-13(6-3-7-14(10)15(17)18)12-5-2-4-11(8-12)9-16/h2-8,16H,9H2,1H3,(H,17,18)

InChI key: InChIKey=HBFWDVGHYAKYRK-UHFFFAOYSA-N

SMILES: CC1=C(C2=CC(CO)=CC=C2)C=CC=C1C(O)=O

Synonyms:

• 3′-(Hydroxymethyl)-2-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-(hydroxymethyl)-2-methyl-